2,3-Dibromo-4,4,4-trifluoro-3-methylbutanoic acid
Modify Date: 2025-09-21 13:40:21
2,3-Dibromo-4,4,4-trifluoro-3-methylbutanoic acid structure
|
Common Name | 2,3-Dibromo-4,4,4-trifluoro-3-methylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 885276-57-3 | Molecular Weight | 313.89500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H5Br2F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-Dibromo-4,4,4-trifluoro-3-methylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H5Br2F3O2 |
|---|---|
| Molecular Weight | 313.89500 |
| Exact Mass | 311.86100 |
| PSA | 37.30000 |
| LogP | 2.55040 |
| InChIKey | VXYLFCNIZVCLAV-UHFFFAOYSA-N |
| SMILES | CC(Br)(C(Br)C(=O)O)C(F)(F)F |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| pc2547 |