[chloro-(4-methylphenyl)sulfonylmethyl]-trimethylsilane structure
|
Common Name | [chloro-(4-methylphenyl)sulfonylmethyl]-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 88534-27-4 | Molecular Weight | 276.85500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17ClO2SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [chloro-(4-methylphenyl)sulfonylmethyl]-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H17ClO2SSi |
|---|---|
| Molecular Weight | 276.85500 |
| Exact Mass | 276.04100 |
| PSA | 42.52000 |
| LogP | 4.71170 |
| InChIKey | WDMBPIADGNZMNS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)C(Cl)[Si](C)(C)C)cc1 |
|
~%
[chloro-(4-meth... CAS#:88534-27-4 |
| Literature: Porskamp, P. A. T. W.; Leij, M. van der; Lammerink, B. H. M.; Zwanenburg, B. Recueil: Journal of the Royal Netherlands Chemical Society, 1983 , vol. 102, # 9 p. 400 - 404 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| chloro(p-tolylsulfonyl)(trimethylsilyl)methane |
| Silane,[chloro[(4-methylphenyl)sulfonyl]methyl]trimethyl |