Methyl 6-nitro-1H-indazole-4-carboxylate structure
|
Common Name | Methyl 6-nitro-1H-indazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 885518-55-8 | Molecular Weight | 221.170 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 443.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C9H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.8±23.2 °C | |
| Name | Methyl 6-nitro-1H-indazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 443.2±25.0 °C at 760 mmHg |
| Molecular Formula | C9H7N3O4 |
| Molecular Weight | 221.170 |
| Flash Point | 221.8±23.2 °C |
| Exact Mass | 221.043655 |
| PSA | 100.80000 |
| LogP | 1.93 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.683 |
| InChIKey | HOJSKHUYDHPZKX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc2[nH]ncc12 |
| HS Code | 2933990090 |
|---|
|
~%
Methyl 6-nitro-... CAS#:885518-55-8 |
| Literature: EP2226315 A1, ; Page/Page column 44-45 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole-4-carboxylic acid, 6-nitro-, methyl ester |
| Methyl 6-nitro-1H-indazole-4-carboxylate |