3-Chloro-6-nitro-1H-indazole-4-carboxylic acid structure
|
Common Name | 3-Chloro-6-nitro-1H-indazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 885519-67-5 | Molecular Weight | 241.588 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 549.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C8H4ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.2±30.1 °C | |
| Name | 3-chloro-6-nitro-2H-indazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 549.7±50.0 °C at 760 mmHg |
| Molecular Formula | C8H4ClN3O4 |
| Molecular Weight | 241.588 |
| Flash Point | 286.2±30.1 °C |
| Exact Mass | 240.989029 |
| PSA | 111.80000 |
| LogP | 2.83 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.777 |
| InChIKey | FIZPEEVUCXYLAP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc2n[nH]c(Cl)c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole-4-carboxylic acid, 3-chloro-6-nitro- |
| 3-Chloro-6-nitro-4-(1H)indazole carboxylic acid |
| 3-Chloro-6-nitro-1H-indazole-4-carboxylic acid |