Methyl 3-bromo-4-nitro-1H-indazole-6-carboxylate structure
|
Common Name | Methyl 3-bromo-4-nitro-1H-indazole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 885521-03-9 | Molecular Weight | 300.066 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 492.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H6BrN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.4±27.3 °C | |
| Name | methyl 3-bromo-4-nitro-2H-indazole-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 492.0±40.0 °C at 760 mmHg |
| Molecular Formula | C9H6BrN3O4 |
| Molecular Weight | 300.066 |
| Flash Point | 251.4±27.3 °C |
| Exact Mass | 298.954163 |
| PSA | 100.80000 |
| LogP | 2.49 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.706 |
| InChIKey | HRBWBPNNDZJPGW-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c2c(Br)[nH]nc2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 3-bromo-4-nitro-1H-indazole-6-carboxylate |
| 3-Bromo-4-nitro-6-indazolecarboxylic acid methyl ester |
| 1H-Indazole-6-carboxylic acid, 3-bromo-4-nitro-, methyl ester |