3-Iodo-4-nitro-1H-indazole structure
|
Common Name | 3-Iodo-4-nitro-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 885521-22-2 | Molecular Weight | 289.030 | |
| Density | 2.2±0.1 g/cm3 | Boiling Point | 458.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C7H4IN3O2 | Melting Point | 210-212ºC | |
| MSDS | N/A | Flash Point | 230.8±23.2 °C | |
| Name | 3-iodo-4-nitro-2H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 458.0±25.0 °C at 760 mmHg |
| Melting Point | 210-212ºC |
| Molecular Formula | C7H4IN3O2 |
| Molecular Weight | 289.030 |
| Flash Point | 230.8±23.2 °C |
| Exact Mass | 288.934814 |
| PSA | 74.50000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.818 |
| InChIKey | AOTAXYVEONHYHY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2n[nH]c(I)c12 |
| HS Code | 2933990090 |
|---|
|
~95%
3-Iodo-4-nitro-... CAS#:885521-22-2 |
| Literature: Array Biopharma, Inc. Patent: US2010/63066 A1, 2010 ; Location in patent: Page/Page column 22 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-iodanyl-4-nitro-2H-indazole |
| iodonitroindazole |
| 3-Iodo-4-nitro-1H-indazole |
| 3-Iodo-4-nitro (1H)indazole |
| 1H-Indazole, 3-iodo-4-nitro- |