4-Bromo-1H-indazole-3-carboxylic acid structure
|
Common Name | 4-Bromo-1H-indazole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 885521-80-2 | Molecular Weight | 241.042 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 493.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C8H5BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.2±23.2 °C | |
| Name | 4-bromo-1H-indazole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 493.4±25.0 °C at 760 mmHg |
| Molecular Formula | C8H5BrN2O2 |
| Molecular Weight | 241.042 |
| Flash Point | 252.2±23.2 °C |
| Exact Mass | 239.953430 |
| PSA | 65.98000 |
| LogP | 2.07 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.766 |
| InChIKey | IQVZPISNPRYBGH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1n[nH]c2cccc(Br)c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole-3-carboxylic acid, 4-bromo- |
| 4-Bromo-3-indazolecarboxylic acid |
| 4-Bromo-3-(1H)indazole carboxylic acid |
| 4-Bromo-1H-indazole-3-carboxylic acid |