3,4,6-Trichloro-1H-indazole structure
|
Common Name | 3,4,6-Trichloro-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 885522-45-2 | Molecular Weight | 221.471 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 377.9±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H3Cl3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2±12.1 °C | |
| Name | 3,4,6-trichloro-2H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.9±37.0 °C at 760 mmHg |
| Molecular Formula | C7H3Cl3N2 |
| Molecular Weight | 221.471 |
| Flash Point | 214.2±12.1 °C |
| Exact Mass | 219.936188 |
| PSA | 28.68000 |
| LogP | 3.46 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.712 |
| InChIKey | DUSLYHDMPAHQAC-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c2c(Cl)[nH]nc2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole, 3,4,6-trichloro- |
| 3,4,6-Trichloro-1H-indazole |