2-butyl-3-[cyclobutylidene(trimethylsilyl)methyl]cyclohex-2-en-1-one structure
|
Common Name | 2-butyl-3-[cyclobutylidene(trimethylsilyl)methyl]cyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 88564-23-2 | Molecular Weight | 290.51600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H30OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-butyl-3-[cyclobutylidene(trimethylsilyl)methyl]cyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H30OSi |
|---|---|
| Molecular Weight | 290.51600 |
| Exact Mass | 290.20700 |
| PSA | 17.07000 |
| LogP | 5.58410 |
| InChIKey | MCILTHRFFLEKFT-UHFFFAOYSA-N |
| SMILES | CCCCC1=C(C(=C2CCC2)[Si](C)(C)C)CCCC1=O |
|
~%
2-butyl-3-[cycl... CAS#:88564-23-2 |
| Literature: Koft, Emil R.; Smith, Amos B. Journal of Organic Chemistry, 1984 , vol. 49, p. 832 - 836 |
|
~%
2-butyl-3-[cycl... CAS#:88564-23-2 |
| Literature: Koft, Emil R.; Smith, Amos B. Journal of Organic Chemistry, 1984 , vol. 49, p. 832 - 836 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Cyclohexen-1-one,2-butyl-3-[cyclobutylidene(trimethylsilyl)methyl] |