Piritetrate
Modify Date: 2025-09-23 11:15:12
Piritetrate structure
|
Common Name | Piritetrate | ||
|---|---|---|---|---|
| CAS Number | 88569-82-8 | Molecular Weight | 324.39700 | |
| Density | 1.286g/cm3 | Boiling Point | 474.4ºC at 760 mmHg | |
| Molecular Formula | C18H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.7ºC | |
| Name | O-naphthalen-2-yl N-(6-methoxypyridin-2-yl)-N-methylcarbamothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 474.4ºC at 760 mmHg |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.39700 |
| Flash Point | 240.7ºC |
| Exact Mass | 324.09300 |
| PSA | 66.68000 |
| LogP | 4.04350 |
| Index of Refraction | 1.693 |
| InChIKey | LMQJRYKENGECRN-UHFFFAOYSA-N |
| SMILES | COc1cccc(N(C)C(=S)Oc2ccc3ccccc3c2)n1 |
| HS Code | 2933399090 |
|---|
|
~83%
Piritetrate CAS#:88569-82-8 |
| Literature: Toyo Soda Manufacturing Company, Limited Patent: US4551169 A1, 1985 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| O-2-naphthyl N-methyl-N-(6-methoxy-2-pyridyl)thiocarbamate |
| Carbamothioic acid,(6-methoxy-2-pyridinyl)methyl-,O-2-naphthalenyl ester |
| O-2-naphthyl N-(6-methoxy-2-pyridyl)-N-methylthiocarbamate |