6-Acetyl-4,4-dimethylthio-chroman structure
|
Common Name | 6-Acetyl-4,4-dimethylthio-chroman | ||
|---|---|---|---|---|
| CAS Number | 88579-23-1 | Molecular Weight | 220.33100 | |
| Density | 1.071g/cm3 | Boiling Point | 353.8ºC at 760 mmHg | |
| Molecular Formula | C13H16OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.618ºC | |
| Name | 1-(4,4-Dimethylthiochroman-6-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.071g/cm3 |
|---|---|
| Boiling Point | 353.8ºC at 760 mmHg |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.33100 |
| Flash Point | 184.618ºC |
| Exact Mass | 220.09200 |
| PSA | 42.37000 |
| LogP | 3.66260 |
| Index of Refraction | 1.554 |
| InChIKey | DHIVJYNSSSHXRG-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)C(C)(C)CCS2 |
| HS Code | 2932999099 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethanone |