N,N-bis(2-chloroethyl)-10-oxo-9-oxa-1-aza-10$l^C11H21Cl2N2O2P-phosphabicyclo[4.4.0]decan-10-amine structure
|
Common Name | N,N-bis(2-chloroethyl)-10-oxo-9-oxa-1-aza-10$l^C11H21Cl2N2O2P-phosphabicyclo[4.4.0]decan-10-amine | ||
|---|---|---|---|---|
| CAS Number | 88584-09-2 | Molecular Weight | 315.17600 | |
| Density | 1.3g/cm3 | Boiling Point | 396ºC at 760 mmHg | |
| Molecular Formula | C11H21Cl2N2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.3ºC | |
| Name | Yperite sulfoxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 396ºC at 760 mmHg |
| Molecular Formula | C11H21Cl2N2O2P |
| Molecular Weight | 315.17600 |
| Flash Point | 193.3ºC |
| Exact Mass | 314.07200 |
| PSA | 42.59000 |
| LogP | 3.08680 |
| Index of Refraction | 1.531 |
| InChIKey | LBHRYWZOYQOZFA-UHFFFAOYSA-N |
| SMILES | O=P1(N(CCCl)CCCl)OCCC2CCCCN21 |
|
~%
N,N-bis(2-chlor... CAS#:88584-09-2 |
| Literature: Friedman,O.M. et al. Journal of Medicinal Chemistry, 1963 , vol. 6, p. 82 - 83 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HD sulfoxide |
| sulfur mustard sulfoxide |
| H sulfoxide |
| 2.2'-Dichlor-diaethylsulfoxyd |
| mustard sulfoxide |