2-(5-Formyl-2-methoxyphenoxy)-2-phenylacetic acid
Modify Date: 2025-08-22 14:04:43
2-(5-Formyl-2-methoxyphenoxy)-2-phenylacetic acid structure
|
Common Name | 2-(5-Formyl-2-methoxyphenoxy)-2-phenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 885949-43-9 | Molecular Weight | 286.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(5-Formyl-2-methoxyphenoxy)-2-phenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14O5 |
|---|---|
| Molecular Weight | 286.27900 |
| Exact Mass | 286.08400 |
| PSA | 72.83000 |
| LogP | 2.71240 |
| InChIKey | UPXUEIMEVCVCLQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=O)cc1OC(C(=O)O)c1ccccc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| formylmethoxyphenoxyphenylaceticacid |