propan-2-yl 2-carbamoyloxybenzoate
Modify Date: 2025-08-26 17:16:24
propan-2-yl 2-carbamoyloxybenzoate structure
|
Common Name | propan-2-yl 2-carbamoyloxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 88599-41-1 | Molecular Weight | 223.22500 | |
| Density | 1.203g/cm3 | Boiling Point | 379.9ºC at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189ºC | |
| Name | propan-2-yl 2-carbamoyloxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 379.9ºC at 760 mmHg |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 189ºC |
| Exact Mass | 223.08400 |
| PSA | 79.61000 |
| LogP | 2.22310 |
| Index of Refraction | 1.532 |
| InChIKey | PPKPDEXFZGRPNQ-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)c1ccccc1OC(N)=O |
| HS Code | 2924299090 |
|---|
|
~%
propan-2-yl 2-c... CAS#:88599-41-1 |
| Literature: Kamal; Rao; Diwan; Sattur European Journal of Medicinal Chemistry, 1988 , vol. 23, # 5 p. 487 - 489 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,2-[(aminocarbonyl)oxy]-,1-methylethyl ester |
| 1-Methylethyl 2-((aminocarbonyl)oxy)benzoate |