(4-chloro-3-methylphenyl) 2-carbamoyloxy-5-chlorobenzoate structure
|
Common Name | (4-chloro-3-methylphenyl) 2-carbamoyloxy-5-chlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 88599-69-3 | Molecular Weight | 340.15800 | |
| Density | 1.43g/cm3 | Boiling Point | 535.8ºC at 760 mmHg | |
| Molecular Formula | C15H11Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.9ºC | |
| Name | (4-chloro-3-methylphenyl) 2-carbamoyloxy-5-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 535.8ºC at 760 mmHg |
| Molecular Formula | C15H11Cl2NO4 |
| Molecular Weight | 340.15800 |
| Flash Point | 277.9ºC |
| Exact Mass | 339.00700 |
| PSA | 79.61000 |
| LogP | 4.49230 |
| Index of Refraction | 1.612 |
| InChIKey | XQCKHALKVIBURQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(OC(=O)c2cc(Cl)ccc2OC(N)=O)ccc1Cl |
|
~%
(4-chloro-3-met... CAS#:88599-69-3 |
| Literature: Kamal; Rao; Diwan; Sattur European Journal of Medicinal Chemistry, 1988 , vol. 23, # 5 p. 487 - 489 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Chloro-3-methylphenyl 2-((aminocarbonyl)oxy)-5-chlorobenzoate |
| Benzoic acid,2-((aminocarbonyl)oxy)-5-chloro-,4-chloro-3-methylphenyl ester |