2-chloro-1-(2,5-dimethylphenyl)propan-1-one structure
|
Common Name | 2-chloro-1-(2,5-dimethylphenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 88632-72-8 | Molecular Weight | 196.67300 | |
| Density | 1.081g/cm3 | Boiling Point | 285.1ºC at 760 mmHg | |
| Molecular Formula | C11H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.8ºC | |
| Name | 2-chloro-1-(2,5-dimethylphenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.081g/cm3 |
|---|---|
| Boiling Point | 285.1ºC at 760 mmHg |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.67300 |
| Flash Point | 154.8ºC |
| Exact Mass | 196.06500 |
| PSA | 17.07000 |
| LogP | 3.11340 |
| Index of Refraction | 1.521 |
| InChIKey | WJDFCWSMCKCWEU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(C(=O)C(C)Cl)c1 |
|
~73%
2-chloro-1-(2,5... CAS#:88632-72-8 |
| Literature: Bergmark, William R.; Barnes, Curtis; Clark, Jeffrey; Paparian, Seth; Marynowski, Susan Journal of Organic Chemistry, 1985 , vol. 50, # 26 p. 5612 - 5615 |
| 2-Chloro-1-(2,5-dimethyl-phenyl)-propan-1-one |
| 1-Propanone,2-chloro-1-(2,5-dimethylphenyl) |