Carbamic acid, N-[1-(2-aminoethyl)cyclohexyl]-, 1,1-dimethylethyl ester structure
|
Common Name | Carbamic acid, N-[1-(2-aminoethyl)cyclohexyl]-, 1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 886362-50-1 | Molecular Weight | 242.35800 | |
| Density | 1g/cm3 | Boiling Point | 352.7ºC at 760 mmHg | |
| Molecular Formula | C13H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.1ºC | |
| Name | tert-butyl N-[1-(2-aminoethyl)cyclohexyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 352.7ºC at 760 mmHg |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.35800 |
| Flash Point | 167.1ºC |
| Exact Mass | 242.19900 |
| PSA | 64.35000 |
| LogP | 3.65400 |
| Index of Refraction | 1.489 |
| InChIKey | YJCLONDHMINYMK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCN)CCCCC1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tert-Butyl (1-(2-aminoethyl)cyclohexyl)carbamate |
| 1-(2-AMINO-ETHYL)-N-BOC-CYCLOHEXYLAMINE |