1-(4-BROMOBUTOXY)-4-METHOXY-BENZENE structure
|
Common Name | 1-(4-BROMOBUTOXY)-4-METHOXY-BENZENE | ||
|---|---|---|---|---|
| CAS Number | 886362-83-0 | Molecular Weight | 278.14400 | |
| Density | 1.48g/cm3 | Boiling Point | 423.8ºC at 760 mmHg | |
| Molecular Formula | C13H12BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.1ºC | |
| Name | 4-[amino-(4-bromophenyl)methyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 423.8ºC at 760 mmHg |
| Molecular Formula | C13H12BrNO |
| Molecular Weight | 278.14400 |
| Flash Point | 210.1ºC |
| Exact Mass | 277.01000 |
| PSA | 46.25000 |
| LogP | 3.90310 |
| Index of Refraction | 1.651 |
| InChIKey | COTBFWYVJVSILN-UHFFFAOYSA-N |
| SMILES | NC(c1ccc(O)cc1)c1ccc(Br)cc1 |
| Storage condition | 2-8℃ |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Phenol,4-[amino(4-bromophenyl)methyl] |
| 4-[Amino(4-bromophenyl)methyl]phenol |
| 1-(4-Bromophenyl)-1-(4-hydroxyphenyl)methylamine |