Benzenepropanoic acid, β-(acetylamino)-4-methyl-
Modify Date: 2025-11-25 11:47:50
Benzenepropanoic acid, β-(acetylamino)-4-methyl- structure
|
Common Name | Benzenepropanoic acid, β-(acetylamino)-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 886363-72-0 | Molecular Weight | 221.25200 | |
| Density | 1.168g/cm3 | Boiling Point | 459.951ºC at 760 mmHg | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.97ºC | |
| Name | 3-acetamido-3-(4-methylphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 459.951ºC at 760 mmHg |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Flash Point | 231.97ºC |
| Exact Mass | 221.10500 |
| PSA | 66.40000 |
| LogP | 2.03780 |
| Index of Refraction | 1.543 |
| InChIKey | CZHBKBNENRJYDU-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC(=O)O)c1ccc(C)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(acetylamino)-3-(4-methylphenyl)propanoic acid |
| 3-Acetamido-3-(p-tolyl)propanoic acid |
| 3-Acetylamino-3-p-tolyl-propionicacid |