3-(4-AMINO-PIPERIDIN-1-YL)-1-(6-CHLORO-PYRIDIN-3-YL)-PROPAN-1-ONE structure
|
Common Name | 3-(4-AMINO-PIPERIDIN-1-YL)-1-(6-CHLORO-PYRIDIN-3-YL)-PROPAN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 886363-81-1 | Molecular Weight | 267.75500 | |
| Density | 1.196g/cm3 | Boiling Point | 429.8ºC at 760 mmHg | |
| Molecular Formula | C13H18ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.7ºC | |
| Name | 3-(4-aminopiperidin-1-yl)-1-(6-chloropyridin-3-yl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 429.8ºC at 760 mmHg |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.75500 |
| Flash Point | 213.7ºC |
| Exact Mass | 267.11400 |
| PSA | 59.22000 |
| LogP | 2.36910 |
| Index of Refraction | 1.557 |
| InChIKey | HEPZQQJHMHCTRB-UHFFFAOYSA-N |
| SMILES | NC1CCN(CCC(=O)c2ccc(Cl)nc2)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| S14-2160 |
| 3-(4-Amino-piperidin-1-yl)-1-(6-chloro-pyridin-3 |
| 3-(4-Amino-piperidin-1-yl)-1-(6-chloro-pyridin-3-yl)-propan-1-one |
| 1-Propanone,3-(4-amino-1-piperidinyl)-1-(6-chloro-3-pyridinyl) |