4-Boc-7,8-Dimethoxy-2,3,4,5-tetrahydro-1H-benzo[e][1,4]diazepine structure
|
Common Name | 4-Boc-7,8-Dimethoxy-2,3,4,5-tetrahydro-1H-benzo[e][1,4]diazepine | ||
|---|---|---|---|---|
| CAS Number | 886364-26-7 | Molecular Weight | 308.37300 | |
| Density | 1.116g/cm3 | Boiling Point | 437.7ºC at 760 mmHg | |
| Molecular Formula | C16H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.5ºC | |
| Name | tert-butyl 7,8-dimethoxy-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.116g/cm3 |
|---|---|
| Boiling Point | 437.7ºC at 760 mmHg |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.37300 |
| Flash Point | 218.5ºC |
| Exact Mass | 308.17400 |
| PSA | 60.03000 |
| LogP | 2.94230 |
| Index of Refraction | 1.516 |
| InChIKey | XNSPGFQVDOLCAR-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)NCCN(C(=O)OC(C)(C)C)C2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 7,8-dimethoxy-2,3-dihydro-1H-benzo[e][1,4]diazepine-4(5H)-carboxylate |
| 4-Boc-7,8-Dimethoxy-2,3,4,5-tetrahydro-1H-benzo[e][1,4]diazepine |