1-(2-(Trifluoromethyl)phenyl)cyclopropanamine hydrochloride structure
|
Common Name | 1-(2-(Trifluoromethyl)phenyl)cyclopropanamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 886366-53-6 | Molecular Weight | 201.18800 | |
| Density | 1.281g/cm3 | Boiling Point | 223.4ºC at 760 mmHg | |
| Molecular Formula | C10H10F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94.5ºC | |
| Name | 1-(2-(Trifluoromethyl)phenyl)cyclopropanamine hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 223.4ºC at 760 mmHg |
| Molecular Formula | C10H10F3N |
| Molecular Weight | 201.18800 |
| Flash Point | 94.5ºC |
| Exact Mass | 201.07700 |
| PSA | 26.02000 |
| LogP | 3.35350 |
| Index of Refraction | 1.507 |
| InChIKey | ONWFXGYSJBPFFU-UHFFFAOYSA-N |
| SMILES | Cl.NC1(c2ccccc2C(F)(F)F)CC1 |
| HS Code | 2921499090 |
|---|
|
~%
1-(2-(Trifluoro... CAS#:886366-53-6 |
| Literature: GLENMARK PHARMACEUTICALS S.A.; GHARAT, Laxmikant Atmaram; MUTHUKAMAN, Nagarajan; KHAIRATKAR-JOSHI, Neelima; KATTIGE, Vidya Ganapati Patent: WO2013/186692 A1, 2013 ; Location in patent: Page/Page column 69; 70 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-[2-(trifluoromethyl)phenyl]cyclopropan-1-amine,hydrochloride |