2-Fluoro-5-(trifluoromethoxy)benzoic acid structure
|
Common Name | 2-Fluoro-5-(trifluoromethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 886497-85-4 | Molecular Weight | 224.109 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 251.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H4F4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.1±25.9 °C | |
| Name | 2-Fluoro-5-(trifluoromethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 251.9±35.0 °C at 760 mmHg |
| Molecular Formula | C8H4F4O3 |
| Molecular Weight | 224.109 |
| Flash Point | 106.1±25.9 °C |
| Exact Mass | 224.009659 |
| PSA | 46.53000 |
| LogP | 3.09 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | CSMVUVGPLMTFIZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(OC(F)(F)F)ccc1F |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| QVR BF EOXFFF |
| Benzoic acid, 2-fluoro-5-(trifluoromethoxy)- |
| α,α,α,6-tetrafluoro-m-anisic acid |
| 2-Fluoro-5-(trifluoromethoxy)benzoic acid |