2'-Methoxy-4'-(trifluoromethoxy)acetophenone
Modify Date: 2025-08-25 12:58:09
2'-Methoxy-4'-(trifluoromethoxy)acetophenone structure
|
Common Name | 2'-Methoxy-4'-(trifluoromethoxy)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 886500-08-9 | Molecular Weight | 234.172 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 262.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H9F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.3±20.8 °C | |
| Name | Ethanone, 1-[2-methoxy-4-(trifluoromethoxy)phenyl] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 262.6±35.0 °C at 760 mmHg |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.172 |
| Flash Point | 109.3±20.8 °C |
| Exact Mass | 234.050385 |
| PSA | 35.53000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | YAMJXZPRMMJVTQ-UHFFFAOYSA-N |
| SMILES | COc1cc(OC(F)(F)F)ccc1C(C)=O |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Ethanone, 1-[2-methoxy-4-(trifluoromethoxy)phenyl]- |
| 1-[2-Methoxy-4-(trifluoromethoxy)phenyl]ethanone |
| FXFFOR DV1 CO1 |
| 2'-Methoxy-4'-(trifluoromethoxy)acetophenone |
| 1-Acetyl-2-methoxy-4-(trifluoromethoxy)benzene |
| 20219369 |