4-Methoxy-2-(trifluoromethoxy)benzyl alcohol structure
|
Common Name | 4-Methoxy-2-(trifluoromethoxy)benzyl alcohol | ||
|---|---|---|---|---|
| CAS Number | 886502-52-9 | Molecular Weight | 222.161 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 245.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H9F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.1±22.5 °C | |
| Name | [4-Methoxy-2-(trifluoromethoxy)phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 245.1±35.0 °C at 760 mmHg |
| Molecular Formula | C9H9F3O3 |
| Molecular Weight | 222.161 |
| Flash Point | 120.1±22.5 °C |
| Exact Mass | 222.050385 |
| PSA | 38.69000 |
| LogP | 1.78 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | KWHDKYNYQDSSHZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CO)c(OC(F)(F)F)c1 |
| HS Code | 2909499000 |
|---|
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Benzenemethanol, 4-methoxy-2-(trifluoromethoxy)- |
| Q1R DO1 BOXFFF |
| 4-Methoxy-2-(trifluoromethoxy)phenylmethanol |
| 4-Methoxy-2-(trifluoromethoxy)benzyl alcohol |
| JRD-1902 |
| 4-Methoxy-2-(trifluoromethoxy)benzenemethanol |
| PC6388 |
| [4-Methoxy-2-(trifluoromethoxy)phenyl]methanol |