2,6-dichloro-4-(trifluoromethoxy)benzoic acid structure
|
Common Name | 2,6-dichloro-4-(trifluoromethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 886502-90-5 | Molecular Weight | 275.00900 | |
| Density | 1.654g/cm3 | Boiling Point | 282.1ºC at 760 mmHg | |
| Molecular Formula | C8H3Cl2F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.4ºC | |
| Name | 2,6-dichloro-4-(trifluoromethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.654g/cm3 |
|---|---|
| Boiling Point | 282.1ºC at 760 mmHg |
| Molecular Formula | C8H3Cl2F3O3 |
| Molecular Weight | 275.00900 |
| Flash Point | 124.4ºC |
| Exact Mass | 273.94100 |
| PSA | 46.53000 |
| LogP | 3.59020 |
| Index of Refraction | 1.514 |
| InChIKey | HJBCPDRNEWTQCH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(Cl)cc(OC(F)(F)F)cc1Cl |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,5-DIBROMO-1,3-THIAZOLE-4-CARBOXAMIDE |
| Benzoic acid,2,6-dichloro-4-(trifluoromethoxy) |
| MFCD06660297 |