[[hydroxy(phenyl)arsoryl]oxy-dimethylstannyl]oxy-phenylarsinic acid structure
|
Common Name | [[hydroxy(phenyl)arsoryl]oxy-dimethylstannyl]oxy-phenylarsinic acid | ||
|---|---|---|---|---|
| CAS Number | 88652-67-9 | Molecular Weight | 550.83300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18As2O6Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [[hydroxy(phenyl)arsoryl]oxy-dimethylstannyl]oxy-phenylarsinic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18As2O6Sn |
|---|---|
| Molecular Weight | 550.83300 |
| Exact Mass | 551.85600 |
| PSA | 120.72000 |
| InChIKey | DFSQSGITRLXGDJ-UHFFFAOYSA-L |
| SMILES | C[Sn](C)(O[As](=O)(O)c1ccccc1)O[As](=O)(O)c1ccccc1 |
|
~80%
[[hydroxy(pheny... CAS#:88652-67-9 |
| Literature: Cunningham, Desmond; Firtear, Padraig; Molloy, Kiaran C.; Zuckerman, Jerald J. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1983 , p. 1523 - 1528 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Stannane,bis[(hydroxyphenylarsinyl)oxy]dimethyl |
| Dimethylzinn-bis-phenylarsonat |