N-(2,5-dimethyl-4-nitrophenyl)benzenesulfonamide structure
|
Common Name | N-(2,5-dimethyl-4-nitrophenyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 88681-03-2 | Molecular Weight | 306.33700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,5-dimethyl-4-nitrophenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14N2O4S |
|---|---|
| Molecular Weight | 306.33700 |
| Exact Mass | 306.06700 |
| PSA | 100.37000 |
| LogP | 4.68940 |
| InChIKey | NOVDGQISQJVZGI-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1NS(=O)(=O)c1ccccc1 |
|
~%
N-(2,5-dimethyl... CAS#:88681-03-2 |
| Literature: Morgan; Micklethwait Journal of the Chemical Society, 1905 , vol. 87, p. 926 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Benzolsulfonsaeure-(2,5-dimethyl-4-nitro-anilid) |
| Benzenesulfonamide,N-(2,5-dimethyl-4-nitrophenyl) |
| 5-Nitro-2-benzolsulfamino-p-xylol |
| benzenesulfonic acid-(2,5-dimethyl-4-nitro-anilide) |