1,3,6,8-TETRAHYDRO-BENZO[1,2-C:3,4-C']DITHIOPHENE-2,7-DIOXIDE structure
|
Common Name | 1,3,6,8-TETRAHYDRO-BENZO[1,2-C:3,4-C']DITHIOPHENE-2,7-DIOXIDE | ||
|---|---|---|---|---|
| CAS Number | 88686-98-0 | Molecular Weight | 226.31500 | |
| Density | 1.63g/cm3 | Boiling Point | 613.7ºC at 760 mmHg | |
| Molecular Formula | C10H10O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.9ºC | |
| Name | 1,3,6,8-tetrahydrothieno[3,4-g][2]benzothiole 2,7-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 613.7ºC at 760 mmHg |
| Molecular Formula | C10H10O2S2 |
| Molecular Weight | 226.31500 |
| Flash Point | 324.9ºC |
| Exact Mass | 226.01200 |
| PSA | 72.56000 |
| LogP | 2.94260 |
| Index of Refraction | 1.798 |
| InChIKey | RXZWGYQLTICBOL-UHFFFAOYSA-N |
| SMILES | O=S1Cc2ccc3c(c2C1)CS(=O)C3 |
| HS Code | 2934999090 |
|---|
|
~72%
1,3,6,8-TETRAHY... CAS#:88686-98-0 |
| Literature: Lin, Lon-Tang Wilson; Hart, Harold Journal of Organic Chemistry, 1984 , vol. 49, # 6 p. 1027 - 1030 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzo[1,2-c:3,4-c']dithiophene,1,3,6,8-tetrahydro-,2,7-dioxide (9CI) |
| 1,3,6,8-TETRAHYDRO-BENZO[1,2-C:3,4-CA'A inverted exclamation markA'A ]DITHIOPHENE-2,7-DIOXIDE |
| 1,3,6,8-Tetrahydro-benzo[1,2-c:3,4-cA'A inverted exclamation markA'A A'A inverted exclamation markA'A ]dithiophene-2,7-dioxide |
| 1,3,6,8-tetrahydrobenzo<1,2-c:3,4-c'>dithiophene 2,7-dioxide |