ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate
Modify Date: 2025-09-18 08:20:19
ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate structure
|
Common Name | ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 88694-45-5 | Molecular Weight | 273.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H19NO3 |
|---|---|
| Molecular Weight | 273.32700 |
| Exact Mass | 273.13600 |
| PSA | 51.32000 |
| LogP | 3.68960 |
| InChIKey | OHUNIEFLVZYKEP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2ccc(OCC=C(C)C)cc2[nH]1 |
|
~%
ethyl 6-(3-meth... CAS#:88694-45-5 |
| Literature: Moody, Christopher J. Journal of the Chemical Society, Chemical Communications, 1983 , # 20 p. 1129 - 1131 |
![4-[(3-Methyl-2-buten-1-yl)oxy]benzaldehyde structure](https://image.chemsrc.com/caspic/390/28090-12-2.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1H-Indole-2-carboxylic acid,6-[(3-methyl-2-butenyl)oxy]-,ethyl ester |
| ethyl 6-(3-methylbut-2-enyloxy)indole-2-carboxylate |