ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate
ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate structure
|
Common Name | ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 88694-45-5 | Molecular Weight | 273.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate, also known as CAS号88694-45-5, molecular formula C16H19NO3, molecular weight 273.32700, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H19NO3 |
|---|---|
| Molecular Weight | 273.32700 |
| Exact Mass | 273.13600 |
| PSA | 51.32000 |
| LogP | 3.68960 |
| InChIKey | OHUNIEFLVZYKEP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2ccc(OCC=C(C)C)cc2[nH]1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 6-(3-meth... CAS#:88694-45-5 |
| Literature: Moody, Christopher J. Journal of the Chemical Society, Chemical Communications, 1983 , # 20 p. 1129 - 1131 |
![4-[(3-Methyl-2-buten-1-yl)oxy]benzaldehyde structure](https://image.chemsrc.com/caspic/390/28090-12-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Indole-2-carboxylic acid,6-[(3-methyl-2-butenyl)oxy]-,ethyl ester |
| ethyl 6-(3-methylbut-2-enyloxy)indole-2-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate? |
| A: CAS number of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate is 88694-45-5. |
| Q: What are the upstream materials of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate? |
| A: Related upstream materials(CAS) of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate: 28090-12-2. |
| Q: What is the molecular formula of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate? |
| A: Molecular formula of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate is C16H19NO3. |
| Q: What is the molecular weight of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate? |
| A: Molecular weight of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate is 273.32700. |
| Q: What is the English name of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate? |
| A: The English name of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate is ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate. |
| Q: What is the polar surface area (PSA) of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate? |
| A: Polar surface area (PSA) of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate is 51.32000. |
| Q: What is the LogP of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate? |
| A: LogP of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate is 3.68960. |
| Q: What is the InChIKey of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate? |
| A: InChIKey of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate is OHUNIEFLVZYKEP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 88694-45-5? |
| A: Chinese name of 88694-45-5 is 88694-45-5. |
| Q: What English synonyms does ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate have? |
| A: English synonyms of ethyl 6-(3-methylbut-2-enoxy)-1H-indole-2-carboxylate: 1H-Indole-2-carboxylic acid,6-[(3-methyl-2-butenyl)oxy]-,ethyl ester, ethyl 6-(3-methylbut-2-enyloxy)indole-2-carboxylate. |