1-hydroxy-4-sulphonatonaphthalene-2-diazonium
1-hydroxy-4-sulphonatonaphthalene-2-diazonium structure
|
Common Name | 1-hydroxy-4-sulphonatonaphthalene-2-diazonium | ||
|---|---|---|---|---|
| CAS Number | 887-77-4 | Molecular Weight | 250.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-Diazonio-4-hydroxynaphthalene-1-sulfonate, also known as 1-hydroxy-4-sulphonatonaphthalene-2-diazonium, is a chemical with CAS number 887-77-4. Its molecular formula is C10H6N2O4S and molecular weight is 250.23100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-diazonio-4-hydroxynaphthalene-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H6N2O4S |
|---|---|
| Molecular Weight | 250.23100 |
| Exact Mass | 250.00500 |
| PSA | 113.96000 |
| LogP | 1.89388 |
| InChIKey | TUXAJHDLJHMOQB-UHFFFAOYSA-N |
| SMILES | N#[N+]c1cc(S(=O)(=O)[O-])c2ccccc2c1O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:36451-09-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-naphthalene sulfonic acid |
| 2-Naphthalenediazonium,1-hydroxy-4-sulfo-,inner salt |
| 1,2-Naphthoquinone diazide-(2)-4-sulfonic acid |
| 1-oxo-2-diazonaphthalene-4-sulfonic acid |
| 1,2-Naphthochinon-2-diazid-4-sulfonsaeure |
| 1-Hydroxy-4-sulphonatonaphthalene-2-diazonium |
| 1,2-Naphtochinon-2-diazid-4-sulfonsaeure |
| 3-diazo-3,4-dihydro-4-oxo-ester |
| 1,2-naphthoquinone-4-sulfonic acid 2-diazide |
| o-Naphthochinon-diazid-4-sulfonsaeure |
| 1-HYDROXY-4-SULFONATONAPHTHALENE-2-DIAZONIUM |
| EINECS 212-959-4 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 3-diazonio-4-hydroxynaphthalene-1-sulfonate? |
| A: Related downstream products(CAS) of 3-diazonio-4-hydroxynaphthalene-1-sulfonate: 36451-09-9. |
| Q: What is the molecular formula of 3-diazonio-4-hydroxynaphthalene-1-sulfonate? |
| A: Molecular formula of 3-diazonio-4-hydroxynaphthalene-1-sulfonate is C10H6N2O4S. |
| Q: What is the polar surface area (PSA) of 3-diazonio-4-hydroxynaphthalene-1-sulfonate? |
| A: Polar surface area (PSA) of 3-diazonio-4-hydroxynaphthalene-1-sulfonate is 113.96000. |
| Q: What is the LogP of 3-diazonio-4-hydroxynaphthalene-1-sulfonate? |
| A: LogP of 3-diazonio-4-hydroxynaphthalene-1-sulfonate is 1.89388. |
| Q: What is the InChIKey of 3-diazonio-4-hydroxynaphthalene-1-sulfonate? |
| A: InChIKey of 3-diazonio-4-hydroxynaphthalene-1-sulfonate is TUXAJHDLJHMOQB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-diazonio-4-hydroxynaphthalene-1-sulfonate? |
| A: Molecular weight of 3-diazonio-4-hydroxynaphthalene-1-sulfonate is 250.23100. |
| Q: What is the SMILES notation of 3-diazonio-4-hydroxynaphthalene-1-sulfonate? |
| A: SMILES notation of 3-diazonio-4-hydroxynaphthalene-1-sulfonate is N#[N+]c1cc(S(=O)(=O)[O-])c2ccccc2c1O. |
| Q: What is the CAS number of 3-diazonio-4-hydroxynaphthalene-1-sulfonate? |
| A: CAS number of 3-diazonio-4-hydroxynaphthalene-1-sulfonate is 887-77-4. |
| Q: What is the Chinese name of 887-77-4? |
| A: Chinese name of 887-77-4 is 887-77-4. |
| Q: What is the English name of 3-diazonio-4-hydroxynaphthalene-1-sulfonate? |
| A: The English name of 3-diazonio-4-hydroxynaphthalene-1-sulfonate is 3-diazonio-4-hydroxynaphthalene-1-sulfonate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |