N-[2,5-di(propan-2-yl)phenyl]acetamide structure
|
Common Name | N-[2,5-di(propan-2-yl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 88702-22-1 | Molecular Weight | 219.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2,5-di(propan-2-yl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H21NO |
|---|---|
| Molecular Weight | 219.32300 |
| Exact Mass | 219.16200 |
| PSA | 32.59000 |
| LogP | 4.54130 |
| InChIKey | ZGFKRBYYODMZAJ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(C(C)C)ccc1C(C)C |
|
~%
N-[2,5-di(propa... CAS#:88702-22-1 |
| Literature: Newton Journal of the American Chemical Society, 1943 , vol. 65, p. 2444 |
|
~%
N-[2,5-di(propa... CAS#:88702-22-1 |
| Literature: Newton Journal of the American Chemical Society, 1943 , vol. 65, p. 2444 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Acetamide,N-[2,5-bis(1-methylethyl)phenyl] |
| acetic acid-(2,5-diisopropyl-anilide) |
| Essigsaeure-(2,5-diisopropyl-anilid) |