2-(3,5-Dichlorophenyl)piperidine
Modify Date: 2026-07-19 17:33:51
2-(3,5-Dichlorophenyl)piperidine structure
|
Common Name | 2-(3,5-Dichlorophenyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 887361-14-0 | Molecular Weight | 230.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3,5-Dichlorophenyl)piperidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13Cl2N |
|---|---|
| Molecular Weight | 230.13 |
| InChIKey | WHPIGIJJCAIISO-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)cc(C2CCCCN2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(3,5-Dichlorophenyl)piperidine? |
| A: SMILES notation of 2-(3,5-Dichlorophenyl)piperidine is Clc1cc(Cl)cc(C2CCCCN2)c1. |
| Q: What is the molecular weight of 2-(3,5-Dichlorophenyl)piperidine? |
| A: Molecular weight of 2-(3,5-Dichlorophenyl)piperidine is 230.13. |
| Q: What is the English name of 2-(3,5-Dichlorophenyl)piperidine? |
| A: The English name of 2-(3,5-Dichlorophenyl)piperidine is 2-(3,5-Dichlorophenyl)piperidine. |
| Q: What is the CAS number of 2-(3,5-Dichlorophenyl)piperidine? |
| A: CAS number of 2-(3,5-Dichlorophenyl)piperidine is 887361-14-0. |
| Q: What is the molecular formula of 2-(3,5-Dichlorophenyl)piperidine? |
| A: Molecular formula of 2-(3,5-Dichlorophenyl)piperidine is C11H13Cl2N. |
| Q: What is the Chinese name of 887361-14-0? |
| A: Chinese name of 887361-14-0 is 887361-14-0. |
| Q: What is the InChIKey of 2-(3,5-Dichlorophenyl)piperidine? |
| A: InChIKey of 2-(3,5-Dichlorophenyl)piperidine is WHPIGIJJCAIISO-UHFFFAOYSA-N. |