(4-CHLOROMETHYL-THIAZOL-2-YL)-PHENYL-AMINE structure
|
Common Name | (4-CHLOROMETHYL-THIAZOL-2-YL)-PHENYL-AMINE | ||
|---|---|---|---|---|
| CAS Number | 88738-08-3 | Molecular Weight | 222.66800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-chlorophenyl)-(5-hydroxycyclopenten-1-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11ClO2 |
|---|---|
| Molecular Weight | 222.66800 |
| Exact Mass | 222.04500 |
| PSA | 37.30000 |
| LogP | 2.60380 |
| InChIKey | BQUHHDLLKDFQIS-UHFFFAOYSA-N |
| SMILES | O=C(C1=CCCC1O)c1ccc(Cl)cc1 |
| HS Code | 2914700090 |
|---|
|
~74%
(4-CHLOROMETHYL... CAS#:88738-08-3 |
| Literature: Little, R. Daniel; Losinski-Dang, Lorraine; Venegas, Manuel G.; Merlic, Craig Tetrahedron Letters, 1983 , vol. 24, # 42 p. 4499 - 4502 |
|
~%
(4-CHLOROMETHYL... CAS#:88738-08-3 |
| Literature: Teng, Wen-Dong; Huang, Rui; Kwong, Cathy Kar-Wing; Shi, Min; Toy, Patrick H. Journal of Organic Chemistry, 2006 , vol. 71, # 1 p. 368 - 371 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| (5-hydroxy-1-cyclopentenyl)-(4-chlorophenyl)-methanone |
| (4-CHLORO-PHENYL)-(5-HYDROXY-CYCLOPENT-1-ENYL)-METHANONE |
| Methanone,(4-chlorophenyl)(5-hydroxy-1-cyclopenten-1-yl) |
| (4-Chlorophenyl)(5-hydroxycyclopent-1-en-1-yl)methanone |