N-[2-(2,4,6-Trichlorophenoxy)ethyl]-1-propanamine hydrobromide (1 :1) structure
|
Common Name | N-[2-(2,4,6-Trichlorophenoxy)ethyl]-1-propanamine hydrobromide (1 :1) | ||
|---|---|---|---|---|
| CAS Number | 887403-27-2 | Molecular Weight | 363.506 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15BrCl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(2,4,6-Trichlorophenoxy)ethyl]-1-propanamine hydrobromide (1 :1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15BrCl3NO |
|---|---|
| Molecular Weight | 363.506 |
| Exact Mass | 360.940247 |
| PSA | 21.26000 |
| LogP | 5.37420 |
| InChIKey | VUXWQMNTCKZKEF-UHFFFAOYSA-N |
| SMILES | Br.CCCNCCOc1c(Cl)cc(Cl)cc1Cl |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-[2-(2,4,6-Trichlorophenoxy)ethyl]-1-propanamine hydrobromide (1:1) |
| 1-Propanamine, N-[2-(2,4,6-trichlorophenoxy)ethyl]-, hydrobromide (1:1) |