ethyl-2-indoloyl-acetate structure
|
Common Name | ethyl-2-indoloyl-acetate | ||
|---|---|---|---|---|
| CAS Number | 887411-77-0 | Molecular Weight | 231.24700 | |
| Density | 1.24g/cm3 | Boiling Point | 391.5ºC at 760 mmHg | |
| Molecular Formula | C13H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.6ºC | |
| Name | ethyl-2-indoloyl-acetate |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 391.5ºC at 760 mmHg |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.24700 |
| Flash Point | 190.6ºC |
| Exact Mass | 231.09000 |
| PSA | 59.16000 |
| LogP | 2.30380 |
| Index of Refraction | 1.605 |
| InChIKey | OLBXRMZOUKRCOM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cc2ccccc2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |