6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione
Modify Date: 2026-07-16 01:01:50
![6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione Structure](https://www.chemsrc.com/extcaspic/491/887466-45-7.png)
6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione structure
|
Common Name | 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 887466-45-7 | Molecular Weight | 321.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23N5O3 |
|---|---|
| Molecular Weight | 321.37 |
| InChIKey | SZSFELOZXZPADN-UHFFFAOYSA-N |
| SMILES | CCOCCCN1C2=NC3C(C(=O)NC(=O)N3C)N2C(C)=C1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione? |
| A: CAS number of 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione is 887466-45-7. |
| Q: What is the InChIKey of 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione? |
| A: InChIKey of 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione is SZSFELOZXZPADN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione? |
| A: Molecular formula of 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione is C15H23N5O3. |
| Q: What is the English name of 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione? |
| A: The English name of 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione is 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione. |
| Q: What is the Chinese name of 887466-45-7? |
| A: Chinese name of 887466-45-7 is 887466-45-7. |
| Q: What is the molecular weight of 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione? |
| A: Molecular weight of 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione is 321.37. |
| Q: What is the SMILES notation of 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione? |
| A: SMILES notation of 6-(3-Ethoxypropyl)-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione is CCOCCCN1C2=NC3C(C(=O)NC(=O)N3C)N2C(C)=C1C. |