(-)-Holostyligone structure
|
Common Name | (-)-Holostyligone | ||
|---|---|---|---|---|
| CAS Number | 887501-28-2 | Molecular Weight | 356.412 | |
| Density | 1.159±0.06 g/cm3 (20 ºC 760 Torr) | Boiling Point | 507.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.6±23.6 °C | |
Use of (-)-Holostyligone(-)-Holostyligone is an aryltetralone lignan from Holostylis reniformis Duch[1]. |
| Name | 1(2H)-Naphthalenone, 3,4-dihydro-4-(4-hydroxy-3-methoxyphenyl)-6,7-dimethoxy-2,3-dimethyl-, (2S,3S,4R) |
|---|---|
| Synonym | More Synonyms |
| Description | (-)-Holostyligone is an aryltetralone lignan from Holostylis reniformis Duch[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.159±0.06 g/cm3 (20 ºC 760 Torr) |
|---|---|
| Boiling Point | 507.0±50.0 °C at 760 mmHg |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.412 |
| Flash Point | 175.6±23.6 °C |
| Exact Mass | 356.162384 |
| PSA | 64.99000 |
| LogP | 4.03 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | LBJCQKYBKIAWHJ-XAAFQQQXSA-N |
| SMILES | COc1cc(C2c3cc(OC)c(OC)cc3C(=O)C(C)C2C)ccc1O |
| Water Solubility | Insuluble (6.4E-3 g/L) (25 ºC) |
| (2S,3S,4R)-4-(4-Hydroxy-3-methoxyphenyl)-6,7-dimethoxy-2,3-dimethyl-3,4-dihydro-1(2H)-naphthalenone |
| 1(2H)-Naphthalenone, 3,4-dihydro-4-(4-hydroxy-3-methoxyphenyl)-6,7-dimethoxy-2,3-dimethyl-, (2S,3S,4R)- |
| Holostyligone |
| (-)-Holostyligone |
| Holostyligone, (-)- |