5-chloro-7-methyl-2H-indazole-3-carboxylic acid structure
|
Common Name | 5-chloro-7-methyl-2H-indazole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 887578-97-4 | Molecular Weight | 210.61700 | |
| Density | 1.55g/cm3 | Boiling Point | 476.7ºC at 760 mmHg | |
| Molecular Formula | C9H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.1ºC | |
| Name | 5-chloro-7-methyl-2H-indazole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 476.7ºC at 760 mmHg |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.61700 |
| Flash Point | 242.1ºC |
| Exact Mass | 210.02000 |
| PSA | 65.98000 |
| LogP | 2.22290 |
| Index of Refraction | 1.713 |
| InChIKey | BVQXQZPIRPZEGM-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)cc2c(C(=O)O)[nH]nc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Chloro-7-methyl-3-indazolecarboxylic acid |
| 5-Chloro-7-methyl-1H-indazole-3-carboxylic acid |