methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate
Modify Date: 2025-11-16 17:58:05
methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate structure
|
Common Name | methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate | ||
|---|---|---|---|---|
| CAS Number | 887635-90-7 | Molecular Weight | 323.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H13N5O3 |
|---|---|
| Molecular Weight | 323.31 |
| InChIKey | YBPXXWQOXRSGQV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cccc(-n2cnnn2)c1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate? |
| A: Molecular weight of methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate is 323.31. |
| Q: What is the English name of methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate? |
| A: The English name of methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate is methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate. |
| Q: What is the SMILES notation of methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate? |
| A: SMILES notation of methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate is COC(=O)c1ccccc1NC(=O)c1cccc(-n2cnnn2)c1. |
| Q: What is the InChIKey of methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate? |
| A: InChIKey of methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate is YBPXXWQOXRSGQV-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 887635-90-7? |
| A: Chinese name of 887635-90-7 is 887635-90-7. |
| Q: What is the molecular formula of methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate? |
| A: Molecular formula of methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate is C16H13N5O3. |
| Q: What is the CAS number of methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate? |
| A: CAS number of methyl 2-(3-(1H-tetrazol-1-yl)benzamido)benzoate is 887635-90-7. |