Bafetinib structure
|
Common Name | Bafetinib | ||
|---|---|---|---|---|
| CAS Number | 887650-05-7 | Molecular Weight | 576.615 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C30H31F3N8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BafetinibLyn-IN-1 is a potent and selective dual Bcr-Abl/Lyn inhibitor, extracted from patent WO2014169128A1. |
| Name | 4-[[(3S)-3-(dimethylamino)pyrrolidin-1-yl]methyl]-N-[4-methyl-3-[(5-pyrimidin-5-ylpyrimidin-2-yl)amino]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Description | Lyn-IN-1 is a potent and selective dual Bcr-Abl/Lyn inhibitor, extracted from patent WO2014169128A1. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C30H31F3N8O |
| Molecular Weight | 576.615 |
| Exact Mass | 576.257263 |
| PSA | 99.17000 |
| LogP | 3.03 |
| Index of Refraction | 1.640 |
| InChIKey | ZOPBZHLJXQAQON-VWLOTQADSA-N |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CCC(N(C)C)C3)c(C(F)(F)F)c2)cc1Nc1ncc(-c2cncnc2)cn1 |
| Benzamide, N-[3-([5,5'-bipyrimidin]-2-ylamino)-4-methylphenyl]-4-[[(3S)-3-(dimethylamino)-1-pyrrolidinyl]methyl]-3-(trifluoromethyl)- |
| N-[3-(5,5'-Bipyrimidin-2-ylamino)-4-methylphenyl]-4-{[(3S)-3-(dimethylamino)-1-pyrrolidinyl]methyl}-3-(trifluoromethyl)benzamide |
| QCR-131 |
| cc-271 |
| INNO-406,NS-187,Bafetinib |
| S1369_Selleck |
| Lyn-IN-1 |