(+)-2,5-epi Goniothalesdiol structure
|
Common Name | (+)-2,5-epi Goniothalesdiol | ||
|---|---|---|---|---|
| CAS Number | 887927-59-5 | Molecular Weight | 266.290 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 429.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.5±22.2 °C | |
Use of (+)-2,5-epi GoniothalesdiolGoniothalesdiol, isolated from the bark of the Malaysian tree G. borneensis, is a tetrahydrofuran compound known to have significant cytotoxic effects against P388 murine leukemia cells and pesticidal |
| Name | (+)-2,5-epi-Goniothalesdiol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.5±45.0 °C at 760 mmHg |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.290 |
| Flash Point | 160.5±22.2 °C |
| Exact Mass | 266.115417 |
| PSA | 75.99000 |
| LogP | 1.42 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | RUDVTXZKYPJLFH-ZZVYKPCYSA-N |
| SMILES | COC(=O)CCC1OC(c2ccccc2)C(O)C1O |
| D-lyxo-Heptonic acid, 4,7-anhydro-2,3-dideoxy-7-C-phenyl-, methyl ester, (7S)- |
| Methyl 3-[(2R,3S,4S,5S)-3,4-dihydroxy-5-phenyltetrahydro-2-furanyl]propanoate |