4-(Aminomethyl)-4-(3,4-dichlorophenyl)cyclohexanol
Modify Date: 2025-11-04 18:26:34
4-(Aminomethyl)-4-(3,4-dichlorophenyl)cyclohexanol structure
|
Common Name | 4-(Aminomethyl)-4-(3,4-dichlorophenyl)cyclohexanol | ||
|---|---|---|---|---|
| CAS Number | 887978-44-1 | Molecular Weight | 274.18600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(Aminomethyl)-4-(3,4-dichlorophenyl)cyclohexanol |
|---|
| Molecular Formula | C13H17Cl2NO |
|---|---|
| Molecular Weight | 274.18600 |
| Exact Mass | 273.06900 |
| PSA | 46.25000 |
| LogP | 3.82510 |
| InChIKey | APRZPAJFSXWXIH-UHFFFAOYSA-N |
| SMILES | NCC1(c2ccc(Cl)c(Cl)c2)CCC(O)CC1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |