benzenesulfonate,benzyl-dimethyl-phenylazanium structure
|
Common Name | benzenesulfonate,benzyl-dimethyl-phenylazanium | ||
|---|---|---|---|---|
| CAS Number | 88802-05-5 | Molecular Weight | 369.47700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzenesulfonate,benzyl-dimethyl-phenylazanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H23NO3S |
|---|---|
| Molecular Weight | 369.47700 |
| Exact Mass | 369.14000 |
| PSA | 65.58000 |
| LogP | 5.12520 |
| InChIKey | RDOKVWIKQINGSM-UHFFFAOYSA-M |
| SMILES | C[N+](C)(Cc1ccccc1)c1ccccc1.O=S(=O)([O-])c1ccccc1 |
|
~%
benzenesulfonat... CAS#:88802-05-5 |
| Literature: Ando, Takashi; Tanabe, Hiroshi; Yamataka, Hiroshi Journal of the American Chemical Society, 1984 , vol. 106, # 7 p. 2084 - 2088 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenemethanaminium,N,N-dimethyl-N-phenyl-,benzenesulfonate |