2-(4-methoxybenzylidene)succinic acid structure
|
Common Name | 2-(4-methoxybenzylidene)succinic acid | ||
|---|---|---|---|---|
| CAS Number | 889-10-1 | Molecular Weight | 236.22100 | |
| Density | 1.338g/cm3 | Boiling Point | 469.7ºC at 760 mmHg | |
| Molecular Formula | C12H12O5 | Melting Point | 186ºC | |
| MSDS | N/A | Flash Point | 184.7ºC | |
| Name | 2-(4-methoxybenzylidene)succinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 469.7ºC at 760 mmHg |
| Melting Point | 186ºC |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22100 |
| Flash Point | 184.7ºC |
| Exact Mass | 236.06800 |
| PSA | 83.83000 |
| LogP | 1.63790 |
| Index of Refraction | 1.608 |
| InChIKey | HZRZZPNSLQASGS-RMKNXTFCSA-N |
| SMILES | COc1ccc(C=C(CC(=O)O)C(=O)O)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Anisyliden-bernsteinsaeure |
| N-p-Methoxybenzoyl-N'-phenyldiimid |
| Anisoylazophenyl |
| Anisoyl-phenyl-diimid |