6-tert-butyl-3,3-dimethyl-1,2,4-trioxan-5-one structure
|
Common Name | 6-tert-butyl-3,3-dimethyl-1,2,4-trioxan-5-one | ||
|---|---|---|---|---|
| CAS Number | 88919-75-9 | Molecular Weight | 188.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-tert-butyl-3,3-dimethyl-1,2,4-trioxan-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H16O4 |
|---|---|
| Molecular Weight | 188.22100 |
| Exact Mass | 188.10500 |
| PSA | 44.76000 |
| LogP | 1.64220 |
| InChIKey | CLMLBSWZUMYARD-UHFFFAOYSA-N |
| SMILES | CC1(C)OOC(C(C)(C)C)C(=O)O1 |
|
~45%
6-tert-butyl-3,... CAS#:88919-75-9 |
| Literature: Jefford, Charles W.; Rossier, Jean-Claude; Richardson, Geoffrey D. Journal of the Chemical Society, Chemical Communications, 1983 , # 19 p. 1064 - 1065 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-(tert-butyl)-3,3-dimethyl-1,2,4-trioxan-5-one |
| 1,2,4-Trioxan-5-one,6-(1,1-dimethylethyl)-3,3-dimethyl |