1,1-Dichloro-1-trimethylsilyl-2-heptanol structure
|
Common Name | 1,1-Dichloro-1-trimethylsilyl-2-heptanol | ||
|---|---|---|---|---|
| CAS Number | 88920-80-3 | Molecular Weight | 257.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H22Cl2OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1-dichloro-1-trimethylsilylheptan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H22Cl2OSi |
|---|---|
| Molecular Weight | 257.27300 |
| Exact Mass | 256.08200 |
| PSA | 20.23000 |
| LogP | 4.39880 |
| InChIKey | OHGNPNQLXCOCCC-UHFFFAOYSA-N |
| SMILES | CCCCCC(O)C(Cl)(Cl)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,1-Dichloro-1-trimethylsilyl-2-heptanol |