7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine
Modify Date: 2026-09-28 11:07:41
![7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine Structure](https://www.chemsrc.com/extcaspic/341/889446-27-9.png)
7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine structure
|
Common Name | 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine | ||
|---|---|---|---|---|
| CAS Number | 889446-27-9 | Molecular Weight | 308.56 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7BrClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H7BrClN3 |
|---|---|
| Molecular Weight | 308.56 |
| InChIKey | YWJRMNPASJCXSD-UHFFFAOYSA-N |
| SMILES | Clc1cnc2[nH]cc(-c3cccc(Br)c3)c2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine? |
| A: Molecular weight of 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine is 308.56. |
| Q: What is the Chinese name of 889446-27-9? |
| A: Chinese name of 889446-27-9 is 889446-27-9. |
| Q: What is the CAS number of 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine? |
| A: CAS number of 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine is 889446-27-9. |
| Q: What is the InChIKey of 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine? |
| A: InChIKey of 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine is YWJRMNPASJCXSD-UHFFFAOYSA-N. |
| Q: What is the English name of 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine? |
| A: The English name of 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine is 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine. |
| Q: What is the SMILES notation of 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine? |
| A: SMILES notation of 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine is Clc1cnc2[nH]cc(-c3cccc(Br)c3)c2n1. |
| Q: What is the molecular formula of 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine? |
| A: Molecular formula of 7-(3-Bromo-phenyl)-2-chloro-5H-pyrrolo[2,3-b]pyrazine is C12H7BrClN3. |