1-[4-[3-(4-acetylphenoxy)propoxy]phenyl]ethanone structure
|
Common Name | 1-[4-[3-(4-acetylphenoxy)propoxy]phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 88949-86-4 | Molecular Weight | 312.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[4-[3-(4-acetylphenoxy)propoxy]phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H20O4 |
|---|---|
| Molecular Weight | 312.36000 |
| Exact Mass | 312.13600 |
| PSA | 52.60000 |
| LogP | 3.93970 |
| InChIKey | YPQDOUIKXGJRCR-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OCCCOc2ccc(C(C)=O)cc2)cc1 |
|
~83%
1-[4-[3-(4-acet... CAS#:88949-86-4 |
| Literature: Kulaksizoglu, Sultan; Goekce, Cansu; Gup, Ramazan Journal of the Chilean Chemical Society, 2012 , vol. 57, # 3 p. 1213 - 1218 |
|
~96%
1-[4-[3-(4-acet... CAS#:88949-86-4 |
| Literature: Singh, Chandan; Verma, Ved Prakash; Naikade, Niraj Krishna; Singh, Ajit Shankar; Hassam, Mohammad; Puri, Sunil K. Journal of Medicinal Chemistry, 2008 , vol. 51, # 23 p. 7581 - 7592 |
| Ethanone,1,1'-[1,3-propanediylbis(oxy-4,1-phenylene)]bis |
| 1,3-Bis-(4-acetyl-phenoxy)-propan |
| 1-{4-[3-(4-acetylphenoxy)propoxy]phenyl}ethanone |
| 1,1'-[propane-1,3-diylbis(oxybenzene-4,1-diyl)]diethanone |
| HMS564I03 |
| 1-{4-[3-(4-acetylphenoxy)propoxy]phenyl}ethan-1-one |
| 1,1'-<1,3-propanediylbis(oxy-4,1-phenylene)>bisethanone |