5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride
5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride structure
|
Common Name | 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 88958-19-4 | Molecular Weight | 235.67000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10ClN3O |
|---|---|
| Molecular Weight | 235.67000 |
| Exact Mass | 235.05100 |
| PSA | 47.78000 |
| LogP | 2.26310 |
| InChIKey | UKSMFJSARYGDQW-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-n2nnc(C(=O)Cl)c2C)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
5-methyl-1-(3-m... CAS#:88958-19-4 |
| Literature: Obushak; Pokhodylo; Pidlypnyi; Matiichuk Russian Journal of Organic Chemistry, 2008 , vol. 44, # 10 p. 1522 - 1527 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-1,2,3-Triazole-4-carbonyl chloride,5-methyl-1-(3-methylphenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride? |
| A: InChIKey of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride is UKSMFJSARYGDQW-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride? |
| A: SMILES notation of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride is Cc1cccc(-n2nnc(C(=O)Cl)c2C)c1. |
| Q: What is the molecular weight of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride? |
| A: Molecular weight of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride is 235.67000. |
| Q: What is the molecular formula of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride? |
| A: Molecular formula of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride is C11H10ClN3O. |
| Q: What is the LogP of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride? |
| A: LogP of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride is 2.26310. |
| Q: What is the CAS number of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride? |
| A: CAS number of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride is 88958-19-4. |
| Q: What is the polar surface area (PSA) of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride? |
| A: Polar surface area (PSA) of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride is 47.78000. |
| Q: What English synonyms does 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride have? |
| A: English synonyms of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride: 1H-1,2,3-Triazole-4-carbonyl chloride,5-methyl-1-(3-methylphenyl). |
| Q: What is the Chinese name of 88958-19-4? |
| A: Chinese name of 88958-19-4 is 88958-19-4. |
| Q: What is the English name of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride? |
| A: The English name of 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride is 5-methyl-1-(3-methylphenyl)triazole-4-carbonyl chloride. |